C21H32N2O6S — CID 178048722
2-[[3-[2-(4-methyl-3-oxopentoxy)ethylamino]-5-(2-methylpropanoyl)benzoyl]amino]ethanesulfinic acid (PubChem CID 178048722) has the molecular formula C21H32N2O6S and a molecular weight of 440.56 g/mol. Its IUPAC name is 2-[[3-[2-(4-methyl-3-oxopentoxy)ethylamino]-5-(2-methylpropanoyl)benzoyl]amino]ethanesulfinic acid.
| Compound Name | 2-[[3-[2-(4-methyl-3-oxopentoxy)ethylamino]-5-(2-methylpropanoyl)benzoyl]amino]ethanesulfinic acid |
|---|---|
| PubChem CID | 178048722 |
| Molecular Formula | C21H32N2O6S |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 2-[[3-[2-(4-methyl-3-oxopentoxy)ethylamino]-5-(2-methylpropanoyl)benzoyl]amino]ethanesulfinic acid |
| SMILES | CC(C)C(=O)CCOCCNc1cc(C(=O)NCCS(=O)O)cc(C(=O)C(C)C)c1 |
| InChI | InChI=1S/C21H32N2O6S/c1-14(2)19(24)5-8-29-9-6-22-18-12-16(20(25)15(3)4)11-17(13-18)21(26)23-7-10-30(27)28/h11-15,22H,5-10H2,1-4H3,(H,23,26)(H,27,28) |
| InChIKey | RCPIOOQVINPWKV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|