C11H7N5 — CID 14245677
2-[(3H-benzimidazol-5-ylamino)methylidene]propanedinitrile (PubChem CID 14245677) has the molecular formula C11H7N5 and a molecular weight of 209.21 g/mol. Its IUPAC name is 2-[(3H-benzimidazol-5-ylamino)methylidene]propanedinitrile.
| Compound Name | 2-[(3H-benzimidazol-5-ylamino)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 14245677 |
| Molecular Formula | C11H7N5 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-[(3H-benzimidazol-5-ylamino)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C11H7N5/c12-4-8(5-13)6-14-9-1-2-10-11(3-9)16-7-15-10/h1-3,6-7,14H,(H,15,16) |
| InChIKey | BPLZUIHRDHMQMW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|