C17H19BrO2 — CID 142459807
2-[4-(3-bromo-2-methylphenyl)phenoxy]acetaldehyde;ethane (PubChem CID 142459807) has the molecular formula C17H19BrO2 and a molecular weight of 335.24 g/mol. Its IUPAC name is 2-[4-(3-bromo-2-methylphenyl)phenoxy]acetaldehyde;ethane.
| Compound Name | 2-[4-(3-bromo-2-methylphenyl)phenoxy]acetaldehyde;ethane |
|---|---|
| PubChem CID | 142459807 |
| Molecular Formula | C17H19BrO2 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-[4-(3-bromo-2-methylphenyl)phenoxy]acetaldehyde;ethane |
| SMILES | CC.Cc1c(Br)cccc1-c1ccc(OCC=O)cc1 |
| InChI | InChI=1S/C15H13BrO2.C2H6/c1-11-14(3-2-4-15(11)16)12-5-7-13(8-6-12)18-10-9-17;1-2/h2-9H,10H2,1H3;1-2H3 |
| InChIKey | APSFWMRTBMOJLD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|