C45H25N5O3 — CID 142461178
5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-3-yl]-8,14,22-trioxa-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene (PubChem CID 142461178) has the molecular formula C45H25N5O3 and a molecular weight of 683.73 g/mol. Its IUPAC name is 5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-3-yl]-8,14,22-trioxa-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-3-yl]-8,14,22-trioxa-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 142461178 |
| Molecular Formula | C45H25N5O3 |
| Molecular Weight | 683.73 g/mol |
| Exact Mass | 683.20 |
| IUPAC Name | 5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-3-yl]-8,14,22-trioxa-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-n3c4ccccc4c4cc(-c5cc6c7c(c5)Oc5cccc8c5N7c5c(cccc5O6)O8)ccc43)n2)cc1 |
| InChI | InChI=1S/C45H25N5O3/c1-3-11-26(12-4-1)43-46-44(27-13-5-2-6-14-27)48-45(47-43)49-32-16-8-7-15-30(32)31-23-28(21-22-33(31)49)29-24-38-42-39(25-29)53-37-20-10-18-35-41(37)50(42)40-34(51-35)17-9-19-36(40)52-38/h1-25H |
| InChIKey | QAKKXRKETHHXNU-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.73 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |