C30H40FN7O2 — CID 142462891
1-[(1R)-3-[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexyl]-3-(5-pentoxypentyl)urea (PubChem CID 142462891) has the molecular formula C30H40FN7O2 and a molecular weight of 549.70 g/mol. Its IUPAC name is 1-[(1R)-3-[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexyl]-3-(5-pentoxypentyl)urea.
| Compound Name | 1-[(1R)-3-[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexyl]-3-(5-pentoxypentyl)urea |
|---|---|
| PubChem CID | 142462891 |
| Molecular Formula | C30H40FN7O2 |
| Molecular Weight | 549.70 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | 1-[(1R)-3-[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexyl]-3-(5-pentoxypentyl)urea |
| SMILES | CCCCCOCCCCCNC(=O)N[C@@H]1CCCC(n2ccc3cnc(-c4c[nH]c5ncc(F)cc45)nc32)C1 |
| InChI | InChI=1S/C30H40FN7O2/c1-2-3-6-14-40-15-7-4-5-12-32-30(39)36-23-9-8-10-24(17-23)38-13-11-21-18-33-28(37-29(21)38)26-20-35-27-25(26)16-22(31)19-34-27/h11,13,16,18-20,23-24H,2-10,12,14-15,17H2,1H3,(H,34,35)(H2,32,36,39)/t23-,24?/m1/s1 |
| InChIKey | XBVOLGINFPONGP-MIHMCVIASA-N |
| XLogP | 6.27 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.70 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|