C25H30N6O2 — CID 22282945
1-benzyl-3-[4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 22282945) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is 1-benzyl-3-[4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-benzyl-3-[4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 22282945 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 1-benzyl-3-[4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | CC1CCN(C(=O)C2CCN(Cc3ccccc3)C2=O)CC1N(C)c1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C25H30N6O2/c1-17-9-12-31(15-21(17)29(2)23-19-8-11-26-22(19)27-16-28-23)25(33)20-10-13-30(24(20)32)14-18-6-4-3-5-7-18/h3-8,11,16-17,20-21H,9-10,12-15H2,1-2H3,(H,26,27,28) |
| InChIKey | CKODHKNZMAPUTK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|