C29H38FN7O3 — CID 142462931
1-[5-(2-ethoxyethoxy)pentyl]-3-[(1R)-3-[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexyl]urea (PubChem CID 142462931) has the molecular formula C29H38FN7O3 and a molecular weight of 551.67 g/mol. Its IUPAC name is 1-[5-(2-ethoxyethoxy)pentyl]-3-[(1R)-3-[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexyl]urea.
| Compound Name | 1-[5-(2-ethoxyethoxy)pentyl]-3-[(1R)-3-[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexyl]urea |
|---|---|
| PubChem CID | 142462931 |
| Molecular Formula | C29H38FN7O3 |
| Molecular Weight | 551.67 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | 1-[5-(2-ethoxyethoxy)pentyl]-3-[(1R)-3-[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexyl]urea |
| SMILES | CCOCCOCCCCCNC(=O)N[C@@H]1CCCC(n2ccc3cnc(-c4c[nH]c5ncc(F)cc45)nc32)C1 |
| InChI | InChI=1S/C29H38FN7O3/c1-2-39-13-14-40-12-5-3-4-10-31-29(38)35-22-7-6-8-23(16-22)37-11-9-20-17-32-27(36-28(20)37)25-19-34-26-24(25)15-21(30)18-33-26/h9,11,15,17-19,22-23H,2-8,10,12-14,16H2,1H3,(H,33,34)(H2,31,35,38)/t22-,23?/m1/s1 |
| InChIKey | QZSHDDPZLPKISK-WTQRLHSKSA-N |
| XLogP | 5.12 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|