C21H22FN5O2 — CID 142463206
7-cyclohexyl-2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,3-d]pyrimidine;methyl formate (PubChem CID 142463206) has the molecular formula C21H22FN5O2 and a molecular weight of 395.44 g/mol. Its IUPAC name is 7-cyclohexyl-2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,3-d]pyrimidine;methyl formate.
| Compound Name | 7-cyclohexyl-2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,3-d]pyrimidine;methyl formate |
|---|---|
| PubChem CID | 142463206 |
| Molecular Formula | C21H22FN5O2 |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 7-cyclohexyl-2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,3-d]pyrimidine;methyl formate |
| SMILES | COC=O.Fc1cnc2[nH]cc(-c3ncc4ccn(C5CCCCC5)c4n3)c2c1 |
| InChI | InChI=1S/C19H18FN5.C2H4O2/c20-13-8-15-16(11-23-17(15)22-10-13)18-21-9-12-6-7-25(19(12)24-18)14-4-2-1-3-5-14;1-4-2-3/h6-11,14H,1-5H2,(H,22,23);2H,1H3 |
| InChIKey | QIPJOLOFMMDKOI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|