C27H41N3OS — CID 142463627
ethane;4-methyl-1-[(5-methyl-2-piperidin-1-yl-1,3-thiazol-4-yl)methyl]pyrrole-2-carbaldehyde;toluene (PubChem CID 142463627) has the molecular formula C27H41N3OS and a molecular weight of 455.71 g/mol. Its IUPAC name is ethane;4-methyl-1-[(5-methyl-2-piperidin-1-yl-1,3-thiazol-4-yl)methyl]pyrrole-2-carbaldehyde;toluene.
| Compound Name | ethane;4-methyl-1-[(5-methyl-2-piperidin-1-yl-1,3-thiazol-4-yl)methyl]pyrrole-2-carbaldehyde;toluene |
|---|---|
| PubChem CID | 142463627 |
| Molecular Formula | C27H41N3OS |
| Molecular Weight | 455.71 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | ethane;4-methyl-1-[(5-methyl-2-piperidin-1-yl-1,3-thiazol-4-yl)methyl]pyrrole-2-carbaldehyde;toluene |
| SMILES | CC.CC.Cc1cc(C=O)n(Cc2nc(N3CCCCC3)sc2C)c1.Cc1ccccc1 |
| InChI | InChI=1S/C16H21N3OS.C7H8.2C2H6/c1-12-8-14(11-20)19(9-12)10-15-13(2)21-16(17-15)18-6-4-3-5-7-18;1-7-5-3-2-4-6-7;2*1-2/h8-9,11H,3-7,10H2,1-2H3;2-6H,1H3;2*1-2H3 |
| InChIKey | RJHPCNGPCCLDQX-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.71 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|