C30H49N5O4S — CID 142464595
N-(2,2-dimethylpropyl)formamide;(4R)-1-formyl-4-hydroxy-N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide;hexan-1-amine (PubChem CID 142464595) has the molecular formula C30H49N5O4S and a molecular weight of 575.82 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)formamide;(4R)-1-formyl-4-hydroxy-N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide;hexan-1-amine.
| Compound Name | N-(2,2-dimethylpropyl)formamide;(4R)-1-formyl-4-hydroxy-N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide;hexan-1-amine |
|---|---|
| PubChem CID | 142464595 |
| Molecular Formula | C30H49N5O4S |
| Molecular Weight | 575.82 g/mol |
| Exact Mass | 575.35 |
| IUPAC Name | N-(2,2-dimethylpropyl)formamide;(4R)-1-formyl-4-hydroxy-N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide;hexan-1-amine |
| SMILES | CC(C)(C)CNC=O.CCCCCCN.Cc1ncsc1-c1ccc(C(C)NC(=O)C2C[C@@H](O)CN2C=O)cc1 |
| InChI | InChI=1S/C18H21N3O3S.C6H13NO.C6H15N/c1-11(20-18(24)16-7-15(23)8-21(16)10-22)13-3-5-14(6-4-13)17-12(2)19-9-25-17;1-6(2,3)4-7-5-8;1-2-3-4-5-6-7/h3-6,9-11,15-16,23H,7-8H2,1-2H3,(H,20,24);5H,4H2,1-3H3,(H,7,8);2-7H2,1H3/t11?,15-,16?;;/m1../s1 |
| InChIKey | MKRRFYZIVJUPAR-GJMHDMQXSA-N |
| XLogP | 4.19 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.82 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|