C30H51FO2 — CID 142465342
(2R,3R,10S,13R,14R,17R)-2-fluoro-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 142465342) has the molecular formula C30H51FO2 and a molecular weight of 462.73 g/mol. Its IUPAC name is (2R,3R,10S,13R,14R,17R)-2-fluoro-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (2R,3R,10S,13R,14R,17R)-2-fluoro-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 142465342 |
| Molecular Formula | C30H51FO2 |
| Molecular Weight | 462.73 g/mol |
| Exact Mass | 462.39 |
| IUPAC Name | (2R,3R,10S,13R,14R,17R)-2-fluoro-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)C[C@@H](F)[C@H](O)C(C)(C)C1CC3 |
| InChI | InChI=1S/C30H51FO2/c1-19(10-9-15-26(2,3)33)20-13-16-30(8)22-11-12-24-27(4,5)25(32)23(31)18-28(24,6)21(22)14-17-29(20,30)7/h19-20,23-25,32-33H,9-18H2,1-8H3/t19-,20-,23-,24?,25+,28-,29-,30+/m1/s1 |
| InChIKey | UMSZQYXOBMKPGY-LHAZUPBKSA-N |
| XLogP | 7.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.73 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|