C39H60O4 — CID 169089025
[(3S,5R,10S,13R,14R,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-phenylmethoxyacetate (PubChem CID 169089025) has the molecular formula C39H60O4 and a molecular weight of 592.91 g/mol. Its IUPAC name is [(3S,5R,10S,13R,14R,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-phenylmethoxyacetate.
| Compound Name | [(3S,5R,10S,13R,14R,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-phenylmethoxyacetate |
|---|---|
| PubChem CID | 169089025 |
| Molecular Formula | C39H60O4 |
| Molecular Weight | 592.91 g/mol |
| Exact Mass | 592.45 |
| IUPAC Name | [(3S,5R,10S,13R,14R,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-phenylmethoxyacetate |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](OC(=O)COCc2ccccc2)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C39H60O4/c1-27(13-12-21-35(2,3)41)29-18-23-39(8)31-16-17-32-36(4,5)33(20-22-37(32,6)30(31)19-24-38(29,39)7)43-34(40)26-42-25-28-14-10-9-11-15-28/h9-11,14-15,27,29,32-33,41H,12-13,16-26H2,1-8H3/t27-,29-,32+,33+,37-,38-,39+/m1/s1 |
| InChIKey | RKWLYQULIMMLLP-PNJGRDDGSA-N |
| XLogP | 9.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.91 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|