C37H54FNO3 — CID 169088837
[(3S,5R,10S,13R,14R,17R)-17-[(2R)-4-[ethyl-(2-fluorobenzoyl)amino]butan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 169088837) has the molecular formula C37H54FNO3 and a molecular weight of 579.84 g/mol. Its IUPAC name is [(3S,5R,10S,13R,14R,17R)-17-[(2R)-4-[ethyl-(2-fluorobenzoyl)amino]butan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5R,10S,13R,14R,17R)-17-[(2R)-4-[ethyl-(2-fluorobenzoyl)amino]butan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 169088837 |
| Molecular Formula | C37H54FNO3 |
| Molecular Weight | 579.84 g/mol |
| Exact Mass | 579.41 |
| IUPAC Name | [(3S,5R,10S,13R,14R,17R)-17-[(2R)-4-[ethyl-(2-fluorobenzoyl)amino]butan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CCN(CC[C@@H](C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](OC(C)=O)C(C)(C)[C@@H]1CC3)C(=O)c1ccccc1F |
| InChI | InChI=1S/C37H54FNO3/c1-9-39(33(41)26-12-10-11-13-30(26)38)23-19-24(2)27-16-21-37(8)29-14-15-31-34(4,5)32(42-25(3)40)18-20-35(31,6)28(29)17-22-36(27,37)7/h10-13,24,27,31-32H,9,14-23H2,1-8H3/t24-,27-,31+,32+,35-,36-,37+/m1/s1 |
| InChIKey | CZTXLZBIWCGYMJ-LANYEUAOSA-N |
| XLogP | 8.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.84 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|