C34H50FNO2 — CID 169088793
2-fluoro-N-[(3R)-3-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]-N-methylbenzamide (PubChem CID 169088793) has the molecular formula C34H50FNO2 and a molecular weight of 523.78 g/mol. Its IUPAC name is 2-fluoro-N-[(3R)-3-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]-N-methylbenzamide.
| Compound Name | 2-fluoro-N-[(3R)-3-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 169088793 |
| Molecular Formula | C34H50FNO2 |
| Molecular Weight | 523.78 g/mol |
| Exact Mass | 523.38 |
| IUPAC Name | 2-fluoro-N-[(3R)-3-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]-N-methylbenzamide |
| SMILES | C[C@H](CCN(C)C(=O)c1ccccc1F)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C34H50FNO2/c1-22(17-21-36(7)30(38)23-10-8-9-11-27(23)35)24-14-19-34(6)26-12-13-28-31(2,3)29(37)16-18-32(28,4)25(26)15-20-33(24,34)5/h8-11,22,24,28-29,37H,12-21H2,1-7H3/t22-,24-,28+,29+,32-,33-,34+/m1/s1 |
| InChIKey | PBKIALAVQLIXSK-UNYKEPPRSA-N |
| XLogP | 8.03 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.78 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|