C32H51N3O2 — CID 169088775
(4R)-4-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methyl-N-(2-methylpyrazol-3-yl)pentanamide (PubChem CID 169088775) has the molecular formula C32H51N3O2 and a molecular weight of 509.78 g/mol. Its IUPAC name is (4R)-4-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methyl-N-(2-methylpyrazol-3-yl)pentanamide.
| Compound Name | (4R)-4-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methyl-N-(2-methylpyrazol-3-yl)pentanamide |
|---|---|
| PubChem CID | 169088775 |
| Molecular Formula | C32H51N3O2 |
| Molecular Weight | 509.78 g/mol |
| Exact Mass | 509.40 |
| IUPAC Name | (4R)-4-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methyl-N-(2-methylpyrazol-3-yl)pentanamide |
| SMILES | C[C@H](CCC(=O)N(C)c1ccnn1C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C32H51N3O2/c1-21(9-12-28(37)34(7)27-16-20-33-35(27)8)22-13-18-32(6)24-10-11-25-29(2,3)26(36)15-17-30(25,4)23(24)14-19-31(22,32)5/h16,20-22,25-26,36H,9-15,17-19H2,1-8H3/t21-,22-,25+,26+,30-,31-,32+/m1/s1 |
| InChIKey | OBSWSHIHUSWHAH-GJDKCOEZSA-N |
| XLogP | 6.91 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.78 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|