C32H44N6O — CID 142467390
ethene;2-[5-[(1E)-3-[(1-methylpiperidin-4-yl)amino]buta-1,3-dienyl]furan-2-yl]-N-(3-piperidin-1-ylpropyl)-1,6-naphthyridin-4-amine (PubChem CID 142467390) has the molecular formula C32H44N6O and a molecular weight of 528.75 g/mol. Its IUPAC name is ethene;2-[5-[(1E)-3-[(1-methylpiperidin-4-yl)amino]buta-1,3-dienyl]furan-2-yl]-N-(3-piperidin-1-ylpropyl)-1,6-naphthyridin-4-amine.
| Compound Name | ethene;2-[5-[(1E)-3-[(1-methylpiperidin-4-yl)amino]buta-1,3-dienyl]furan-2-yl]-N-(3-piperidin-1-ylpropyl)-1,6-naphthyridin-4-amine |
|---|---|
| PubChem CID | 142467390 |
| Molecular Formula | C32H44N6O |
| Molecular Weight | 528.75 g/mol |
| Exact Mass | 528.36 |
| IUPAC Name | ethene;2-[5-[(1E)-3-[(1-methylpiperidin-4-yl)amino]buta-1,3-dienyl]furan-2-yl]-N-(3-piperidin-1-ylpropyl)-1,6-naphthyridin-4-amine |
| SMILES | C=C.C=C(/C=C/c1ccc(-c2cc(NCCCN3CCCCC3)c3cnccc3n2)o1)NC1CCN(C)CC1 |
| InChI | InChI=1S/C30H40N6O.C2H4/c1-23(33-24-12-19-35(2)20-13-24)7-8-25-9-10-30(37-25)29-21-28(26-22-31-15-11-27(26)34-29)32-14-6-18-36-16-4-3-5-17-36;1-2/h7-11,15,21-22,24,33H,1,3-6,12-14,16-20H2,2H3,(H,32,34);1-2H2/b8-7+; |
| InChIKey | MFMUGEIUWKBCIM-USRGLUTNSA-N |
| XLogP | 6.19 |
| TPSA | 69.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.75 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|