C18H28N2 — CID 142467422
ethane;N-[(3E)-penta-1,3-dien-2-yl]-4-(pyrrolidin-1-ylmethyl)aniline (PubChem CID 142467422) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is ethane;N-[(3E)-penta-1,3-dien-2-yl]-4-(pyrrolidin-1-ylmethyl)aniline.
| Compound Name | ethane;N-[(3E)-penta-1,3-dien-2-yl]-4-(pyrrolidin-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 142467422 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | ethane;N-[(3E)-penta-1,3-dien-2-yl]-4-(pyrrolidin-1-ylmethyl)aniline |
| SMILES | C=C(/C=C/C)Nc1ccc(CN2CCCC2)cc1.CC |
| InChI | InChI=1S/C16H22N2.C2H6/c1-3-6-14(2)17-16-9-7-15(8-10-16)13-18-11-4-5-12-18;1-2/h3,6-10,17H,2,4-5,11-13H2,1H3;1-2H3/b6-3+; |
| InChIKey | VANRHOITEYWNNQ-ZIKNSQGESA-N |
| XLogP | 4.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|