C14H22N4O2 — CID 142467552
2-methylpropyl 4-(5-methylpyrimidin-2-yl)piperazine-2-carboxylate (PubChem CID 142467552) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-methylpropyl 4-(5-methylpyrimidin-2-yl)piperazine-2-carboxylate.
| Compound Name | 2-methylpropyl 4-(5-methylpyrimidin-2-yl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 142467552 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-methylpropyl 4-(5-methylpyrimidin-2-yl)piperazine-2-carboxylate |
| SMILES | Cc1cnc(N2CCNC(C(=O)OCC(C)C)C2)nc1 |
| InChI | InChI=1S/C14H22N4O2/c1-10(2)9-20-13(19)12-8-18(5-4-15-12)14-16-6-11(3)7-17-14/h6-7,10,12,15H,4-5,8-9H2,1-3H3 |
| InChIKey | LNLNNVXYLYZZON-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |