C21H37NO6 — CID 142467709
ethane;[methyl(4-oxobutanoyl)amino] 3-[2-methyl-4-(2-methylpent-4-yn-2-yloxy)butan-2-yl]oxypropanoate (PubChem CID 142467709) has the molecular formula C21H37NO6 and a molecular weight of 399.53 g/mol. Its IUPAC name is ethane;[methyl(4-oxobutanoyl)amino] 3-[2-methyl-4-(2-methylpent-4-yn-2-yloxy)butan-2-yl]oxypropanoate.
| Compound Name | ethane;[methyl(4-oxobutanoyl)amino] 3-[2-methyl-4-(2-methylpent-4-yn-2-yloxy)butan-2-yl]oxypropanoate |
|---|---|
| PubChem CID | 142467709 |
| Molecular Formula | C21H37NO6 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | ethane;[methyl(4-oxobutanoyl)amino] 3-[2-methyl-4-(2-methylpent-4-yn-2-yloxy)butan-2-yl]oxypropanoate |
| SMILES | C#CCC(C)(C)OCCC(C)(C)OCCC(=O)ON(C)C(=O)CCC=O.CC |
| InChI | InChI=1S/C19H31NO6.C2H6/c1-7-11-18(2,3)25-15-12-19(4,5)24-14-10-17(23)26-20(6)16(22)9-8-13-21;1-2/h1,13H,8-12,14-15H2,2-6H3;1-2H3 |
| InChIKey | WGLPHQJGXVUBCD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|