C12H9F5N4O2 — CID 142469774
4-(2,2,3,3,3-pentafluoropropoxy)-1-pyridin-3-ylpyrazole-3-carboxamide (PubChem CID 142469774) has the molecular formula C12H9F5N4O2 and a molecular weight of 336.22 g/mol. Its IUPAC name is 4-(2,2,3,3,3-pentafluoropropoxy)-1-pyridin-3-ylpyrazole-3-carboxamide.
| Compound Name | 4-(2,2,3,3,3-pentafluoropropoxy)-1-pyridin-3-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 142469774 |
| Molecular Formula | C12H9F5N4O2 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 4-(2,2,3,3,3-pentafluoropropoxy)-1-pyridin-3-ylpyrazole-3-carboxamide |
| SMILES | NC(=O)c1nn(-c2cccnc2)cc1OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H9F5N4O2/c13-11(14,12(15,16)17)6-23-8-5-21(20-9(8)10(18)22)7-2-1-3-19-4-7/h1-5H,6H2,(H2,18,22) |
| InChIKey | OFJQFKGFITXYJM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|