C13H14FN3O3 — CID 66610665
1-(4-fluorophenyl)-4-(2-methoxyethoxy)pyrazole-3-carboxamide (PubChem CID 66610665) has the molecular formula C13H14FN3O3 and a molecular weight of 279.27 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(2-methoxyethoxy)pyrazole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-4-(2-methoxyethoxy)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 66610665 |
| Molecular Formula | C13H14FN3O3 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(2-methoxyethoxy)pyrazole-3-carboxamide |
| SMILES | COCCOc1cn(-c2ccc(F)cc2)nc1C(N)=O |
| InChI | InChI=1S/C13H14FN3O3/c1-19-6-7-20-11-8-17(16-12(11)13(15)18)10-4-2-9(14)3-5-10/h2-5,8H,6-7H2,1H3,(H2,15,18) |
| InChIKey | IVZLBDBOPSSMQC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|