C22H19ClFN5O2S2 — CID 121061946
N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(4-fluorophenyl)-4-propoxypyrazole-3-carboxamide (PubChem CID 121061946) has the molecular formula C22H19ClFN5O2S2 and a molecular weight of 504.01 g/mol. Its IUPAC name is N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(4-fluorophenyl)-4-propoxypyrazole-3-carboxamide.
| Compound Name | N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(4-fluorophenyl)-4-propoxypyrazole-3-carboxamide |
|---|---|
| PubChem CID | 121061946 |
| Molecular Formula | C22H19ClFN5O2S2 |
| Molecular Weight | 504.01 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(4-fluorophenyl)-4-propoxypyrazole-3-carboxamide |
| SMILES | CCCOc1cn(-c2ccc(F)cc2)nc1C(=O)Nc1nnc(SCc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C22H19ClFN5O2S2/c1-2-11-31-18-12-29(17-9-7-16(24)8-10-17)28-19(18)20(30)25-21-26-27-22(33-21)32-13-14-3-5-15(23)6-4-14/h3-10,12H,2,11,13H2,1H3,(H,25,26,30) |
| InChIKey | PYSIOGNDUBIYAH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.01 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|