C13H21N — CID 142470149
2-(2-cyclohexa-1,5-dien-1-ylethyl)piperidine (PubChem CID 142470149) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 2-(2-cyclohexa-1,5-dien-1-ylethyl)piperidine.
| Compound Name | 2-(2-cyclohexa-1,5-dien-1-ylethyl)piperidine |
|---|---|
| PubChem CID | 142470149 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 2-(2-cyclohexa-1,5-dien-1-ylethyl)piperidine |
| SMILES | C1=CC(CCC2CCCCN2)=CCC1 |
| InChI | InChI=1S/C13H21N/c1-2-6-12(7-3-1)9-10-13-8-4-5-11-14-13/h2,6-7,13-14H,1,3-5,8-11H2 |
| InChIKey | WABZKBHADMQPOZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |