C20H23ClFNO2S — CID 142470240
2-[2-(3-chloro-4-fluorophenyl)ethyl]-1-(4-methylphenyl)sulfonylpiperidine (PubChem CID 142470240) has the molecular formula C20H23ClFNO2S and a molecular weight of 395.93 g/mol. Its IUPAC name is 2-[2-(3-chloro-4-fluorophenyl)ethyl]-1-(4-methylphenyl)sulfonylpiperidine.
| Compound Name | 2-[2-(3-chloro-4-fluorophenyl)ethyl]-1-(4-methylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 142470240 |
| Molecular Formula | C20H23ClFNO2S |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-[2-(3-chloro-4-fluorophenyl)ethyl]-1-(4-methylphenyl)sulfonylpiperidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2CCc2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H23ClFNO2S/c1-15-5-10-18(11-6-15)26(24,25)23-13-3-2-4-17(23)9-7-16-8-12-20(22)19(21)14-16/h5-6,8,10-12,14,17H,2-4,7,9,13H2,1H3 |
| InChIKey | BOHMBKXSSAMILA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |