C16H19N3O2S — CID 142471308
ethyl 2-cyclopentylsulfanyl-3-pyridin-3-ylimidazole-4-carboxylate (PubChem CID 142471308) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is ethyl 2-cyclopentylsulfanyl-3-pyridin-3-ylimidazole-4-carboxylate.
| Compound Name | ethyl 2-cyclopentylsulfanyl-3-pyridin-3-ylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 142471308 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | ethyl 2-cyclopentylsulfanyl-3-pyridin-3-ylimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnc(SC2CCCC2)n1-c1cccnc1 |
| InChI | InChI=1S/C16H19N3O2S/c1-2-21-15(20)14-11-18-16(22-13-7-3-4-8-13)19(14)12-6-5-9-17-10-12/h5-6,9-11,13H,2-4,7-8H2,1H3 |
| InChIKey | UUXHXVWMWZSIOZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |