C20H23FN8O — CID 142472118
5-(4-cyclopropylimidazol-1-yl)-N-[6-(dihydrazinylmethyl)-2-pyridinyl]-2-fluoro-4-methylbenzamide (PubChem CID 142472118) has the molecular formula C20H23FN8O and a molecular weight of 410.46 g/mol. Its IUPAC name is 5-(4-cyclopropylimidazol-1-yl)-N-[6-(dihydrazinylmethyl)-2-pyridinyl]-2-fluoro-4-methylbenzamide.
| Compound Name | 5-(4-cyclopropylimidazol-1-yl)-N-[6-(dihydrazinylmethyl)-2-pyridinyl]-2-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 142472118 |
| Molecular Formula | C20H23FN8O |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 5-(4-cyclopropylimidazol-1-yl)-N-[6-(dihydrazinylmethyl)-2-pyridinyl]-2-fluoro-4-methylbenzamide |
| SMILES | Cc1cc(F)c(C(=O)Nc2cccc(C(NN)NN)n2)cc1-n1cnc(C2CC2)c1 |
| InChI | InChI=1S/C20H23FN8O/c1-11-7-14(21)13(8-17(11)29-9-16(24-10-29)12-5-6-12)20(30)26-18-4-2-3-15(25-18)19(27-22)28-23/h2-4,7-10,12,19,27-28H,5-6,22-23H2,1H3,(H,25,26,30) |
| InChIKey | DICFDIBUJLSIAB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 135.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|