C22H29FN8O — CID 142472152
5-(4-cyclopropylimidazol-1-yl)-2-fluoro-N-[6-[(Z)-N'-hydrazinylcarbamimidoyl]-2-pyridinyl]-4-methylbenzamide;ethane;molecular hydrogen (PubChem CID 142472152) has the molecular formula C22H29FN8O and a molecular weight of 440.53 g/mol. Its IUPAC name is 5-(4-cyclopropylimidazol-1-yl)-2-fluoro-N-[6-[(Z)-N'-hydrazinylcarbamimidoyl]-2-pyridinyl]-4-methylbenzamide;ethane;molecular hydrogen.
| Compound Name | 5-(4-cyclopropylimidazol-1-yl)-2-fluoro-N-[6-[(Z)-N'-hydrazinylcarbamimidoyl]-2-pyridinyl]-4-methylbenzamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 142472152 |
| Molecular Formula | C22H29FN8O |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 5-(4-cyclopropylimidazol-1-yl)-2-fluoro-N-[6-[(Z)-N'-hydrazinylcarbamimidoyl]-2-pyridinyl]-4-methylbenzamide;ethane;molecular hydrogen |
| SMILES | CC.Cc1cc(F)c(C(=O)Nc2cccc(/C(N)=N/NN)n2)cc1-n1cnc(C2CC2)c1.[H][H] |
| InChI | InChI=1S/C20H21FN8O.C2H6.H2/c1-11-7-14(21)13(8-17(11)29-9-16(24-10-29)12-5-6-12)20(30)26-18-4-2-3-15(25-18)19(22)27-28-23;1-2;/h2-4,7-10,12,28H,5-6,23H2,1H3,(H2,22,27)(H,25,26,30);1-2H3;1H |
| InChIKey | OGHRBAYLCYHKIJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 136.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|