C24H30FN7O — CID 142472157
N-[6-[aminomethyl(2-methylpropanimidoyl)amino]-2-pyridinyl]-5-(4-cyclopropylimidazol-1-yl)-2-fluoro-4-methylbenzamide;molecular hydrogen (PubChem CID 142472157) has the molecular formula C24H30FN7O and a molecular weight of 451.55 g/mol. Its IUPAC name is N-[6-[aminomethyl(2-methylpropanimidoyl)amino]-2-pyridinyl]-5-(4-cyclopropylimidazol-1-yl)-2-fluoro-4-methylbenzamide;molecular hydrogen.
| Compound Name | N-[6-[aminomethyl(2-methylpropanimidoyl)amino]-2-pyridinyl]-5-(4-cyclopropylimidazol-1-yl)-2-fluoro-4-methylbenzamide;molecular hydrogen |
|---|---|
| PubChem CID | 142472157 |
| Molecular Formula | C24H30FN7O |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | N-[6-[aminomethyl(2-methylpropanimidoyl)amino]-2-pyridinyl]-5-(4-cyclopropylimidazol-1-yl)-2-fluoro-4-methylbenzamide;molecular hydrogen |
| SMILES | [H]/N=C(\C(C)C)N(CN)c1cccc(NC(=O)c2cc(-n3cnc(C4CC4)c3)c(C)cc2F)n1.[H][H] |
| InChI | InChI=1S/C24H28FN7O.H2/c1-14(2)23(27)32(12-26)22-6-4-5-21(29-22)30-24(33)17-10-20(15(3)9-18(17)25)31-11-19(28-13-31)16-7-8-16;/h4-6,9-11,13-14,16,27H,7-8,12,26H2,1-3H3,(H,29,30,33);1H/b27-23+; |
| InChIKey | UCXBXAUNDHVJAC-VZXOMLSWSA-N |
| XLogP | 4.45 |
| TPSA | 112.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|