C27H34ClN3Si — CID 142472983
6-chloro-N-[2-[3-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl]ethyl]pyrimidin-4-amine (PubChem CID 142472983) has the molecular formula C27H34ClN3Si and a molecular weight of 464.13 g/mol. Its IUPAC name is 6-chloro-N-[2-[3-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl]ethyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[2-[3-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl]ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 142472983 |
| Molecular Formula | C27H34ClN3Si |
| Molecular Weight | 464.13 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 6-chloro-N-[2-[3-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl]ethyl]pyrimidin-4-amine |
| SMILES | CC(C)[Si](C#Cc1cc2ccccc2cc1CCNc1cc(Cl)ncn1)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H34ClN3Si/c1-19(2)32(20(3)4,21(5)6)14-12-25-16-23-10-8-7-9-22(23)15-24(25)11-13-29-27-17-26(28)30-18-31-27/h7-10,15-21H,11,13H2,1-6H3,(H,29,30,31) |
| InChIKey | TXLSXLUAXKZYSS-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.13 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|