C17H26N4O2 — CID 142473522
N-[[2-[(1-aminoethylideneamino)methyl]phenyl]methyl]-N-(2-amino-2-oxoethyl)-2,2-dimethylpropanamide (PubChem CID 142473522) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[[2-[(1-aminoethylideneamino)methyl]phenyl]methyl]-N-(2-amino-2-oxoethyl)-2,2-dimethylpropanamide.
| Compound Name | N-[[2-[(1-aminoethylideneamino)methyl]phenyl]methyl]-N-(2-amino-2-oxoethyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 142473522 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | N-[[2-[(1-aminoethylideneamino)methyl]phenyl]methyl]-N-(2-amino-2-oxoethyl)-2,2-dimethylpropanamide |
| SMILES | C/C(N)=N\Cc1ccccc1CN(CC(N)=O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C17H26N4O2/c1-12(18)20-9-13-7-5-6-8-14(13)10-21(11-15(19)22)16(23)17(2,3)4/h5-8H,9-11H2,1-4H3,(H2,18,20)(H2,19,22) |
| InChIKey | HQVIVXKDYCIVBO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|