C16H22N2OS — CID 142473868
2,5-dimethyl-4-(3-methylsulfanylphenoxy)aniline;methanamine (PubChem CID 142473868) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 2,5-dimethyl-4-(3-methylsulfanylphenoxy)aniline;methanamine.
| Compound Name | 2,5-dimethyl-4-(3-methylsulfanylphenoxy)aniline;methanamine |
|---|---|
| PubChem CID | 142473868 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2,5-dimethyl-4-(3-methylsulfanylphenoxy)aniline;methanamine |
| SMILES | CN.CSc1cccc(Oc2cc(C)c(N)cc2C)c1 |
| InChI | InChI=1S/C15H17NOS.CH5N/c1-10-8-15(11(2)7-14(10)16)17-12-5-4-6-13(9-12)18-3;1-2/h4-9H,16H2,1-3H3;2H2,1H3 |
| InChIKey | GBJHGBCIVKYZDD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|