C21H22N2O2S — CID 153491952
2,5-dimethyl-4-[3-(S-methyl-N-phenylsulfonimidoyl)phenoxy]aniline (PubChem CID 153491952) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is 2,5-dimethyl-4-[3-(S-methyl-N-phenylsulfonimidoyl)phenoxy]aniline.
| Compound Name | 2,5-dimethyl-4-[3-(S-methyl-N-phenylsulfonimidoyl)phenoxy]aniline |
|---|---|
| PubChem CID | 153491952 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2,5-dimethyl-4-[3-(S-methyl-N-phenylsulfonimidoyl)phenoxy]aniline |
| SMILES | Cc1cc(Oc2cccc(S(C)(=O)=Nc3ccccc3)c2)c(C)cc1N |
| InChI | InChI=1S/C21H22N2O2S/c1-15-13-21(16(2)12-20(15)22)25-18-10-7-11-19(14-18)26(3,24)23-17-8-5-4-6-9-17/h4-14H,22H2,1-3H3 |
| InChIKey | JQHIVGIURYCURF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|