C31H35N3O2S — CID 142474717
benzamide;N-[5-(tert-butylamino)sulfanylnaphthalen-1-yl]-3-(2-methylphenyl)propanamide (PubChem CID 142474717) has the molecular formula C31H35N3O2S and a molecular weight of 513.71 g/mol. Its IUPAC name is benzamide;N-[5-(tert-butylamino)sulfanylnaphthalen-1-yl]-3-(2-methylphenyl)propanamide.
| Compound Name | benzamide;N-[5-(tert-butylamino)sulfanylnaphthalen-1-yl]-3-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 142474717 |
| Molecular Formula | C31H35N3O2S |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | benzamide;N-[5-(tert-butylamino)sulfanylnaphthalen-1-yl]-3-(2-methylphenyl)propanamide |
| SMILES | Cc1ccccc1CCC(=O)Nc1cccc2c(SNC(C)(C)C)cccc12.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H28N2OS.C7H7NO/c1-17-9-5-6-10-18(17)15-16-23(27)25-21-13-7-12-20-19(21)11-8-14-22(20)28-26-24(2,3)4;8-7(9)6-4-2-1-3-5-6/h5-14,26H,15-16H2,1-4H3,(H,25,27);1-5H,(H2,8,9) |
| InChIKey | XLGOYHZDQVIFRG-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|