C30H30ClN3O2S — CID 146544907
N-[(2S)-1-[[5-(tert-butylamino)sulfanylnaphthalen-1-yl]amino]-3-(2-chlorophenyl)-1-oxopropan-2-yl]benzamide (PubChem CID 146544907) has the molecular formula C30H30ClN3O2S and a molecular weight of 532.11 g/mol. Its IUPAC name is N-[(2S)-1-[[5-(tert-butylamino)sulfanylnaphthalen-1-yl]amino]-3-(2-chlorophenyl)-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-[[5-(tert-butylamino)sulfanylnaphthalen-1-yl]amino]-3-(2-chlorophenyl)-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 146544907 |
| Molecular Formula | C30H30ClN3O2S |
| Molecular Weight | 532.11 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | N-[(2S)-1-[[5-(tert-butylamino)sulfanylnaphthalen-1-yl]amino]-3-(2-chlorophenyl)-1-oxopropan-2-yl]benzamide |
| SMILES | CC(C)(C)NSc1cccc2c(NC(=O)[C@H](Cc3ccccc3Cl)NC(=O)c3ccccc3)cccc12 |
| InChI | InChI=1S/C30H30ClN3O2S/c1-30(2,3)34-37-27-18-10-14-22-23(27)15-9-17-25(22)32-29(36)26(19-21-13-7-8-16-24(21)31)33-28(35)20-11-5-4-6-12-20/h4-18,26,34H,19H2,1-3H3,(H,32,36)(H,33,35)/t26-/m0/s1 |
| InChIKey | LKYHRHZGYIDFIE-SANMLTNESA-N |
| XLogP | 6.87 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.11 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|