C17H24N2O3 — CID 142475096
methyl 4-(2,3-diethylbenzoyl)piperazine-1-carboxylate (PubChem CID 142475096) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl 4-(2,3-diethylbenzoyl)piperazine-1-carboxylate.
| Compound Name | methyl 4-(2,3-diethylbenzoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142475096 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | methyl 4-(2,3-diethylbenzoyl)piperazine-1-carboxylate |
| SMILES | CCc1cccc(C(=O)N2CCN(C(=O)OC)CC2)c1CC |
| InChI | InChI=1S/C17H24N2O3/c1-4-13-7-6-8-15(14(13)5-2)16(20)18-9-11-19(12-10-18)17(21)22-3/h6-8H,4-5,9-12H2,1-3H3 |
| InChIKey | RZORWBIEKZALET-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |