C20H31NO2 — CID 142475237
2,5-dimethyl-N-(oxan-4-ylmethyl)-2-phenoxyhex-4-en-3-amine (PubChem CID 142475237) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 2,5-dimethyl-N-(oxan-4-ylmethyl)-2-phenoxyhex-4-en-3-amine.
| Compound Name | 2,5-dimethyl-N-(oxan-4-ylmethyl)-2-phenoxyhex-4-en-3-amine |
|---|---|
| PubChem CID | 142475237 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 2,5-dimethyl-N-(oxan-4-ylmethyl)-2-phenoxyhex-4-en-3-amine |
| SMILES | CC(C)=CC(NCC1CCOCC1)C(C)(C)Oc1ccccc1 |
| InChI | InChI=1S/C20H31NO2/c1-16(2)14-19(21-15-17-10-12-22-13-11-17)20(3,4)23-18-8-6-5-7-9-18/h5-9,14,17,19,21H,10-13,15H2,1-4H3 |
| InChIKey | DBQHCRJUYDGOQW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|