C26H29FN4O — CID 142475573
cyclobutyl-[5-[(2-fluorophenyl)methyl]spiro[5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-3,4'-piperidine]-1'-yl]methanone (PubChem CID 142475573) has the molecular formula C26H29FN4O and a molecular weight of 432.54 g/mol. Its IUPAC name is cyclobutyl-[5-[(2-fluorophenyl)methyl]spiro[5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-3,4'-piperidine]-1'-yl]methanone.
| Compound Name | cyclobutyl-[5-[(2-fluorophenyl)methyl]spiro[5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-3,4'-piperidine]-1'-yl]methanone |
|---|---|
| PubChem CID | 142475573 |
| Molecular Formula | C26H29FN4O |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | cyclobutyl-[5-[(2-fluorophenyl)methyl]spiro[5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-3,4'-piperidine]-1'-yl]methanone |
| SMILES | O=C(C1CCC1)N1CCC2(CC1)CN(Cc1ccccc1F)Cc1[nH]c3ncccc3c12 |
| InChI | InChI=1S/C26H29FN4O/c27-21-9-2-1-5-19(21)15-30-16-22-23(20-8-4-12-28-24(20)29-22)26(17-30)10-13-31(14-11-26)25(32)18-6-3-7-18/h1-2,4-5,8-9,12,18H,3,6-7,10-11,13-17H2,(H,28,29) |
| InChIKey | OXXXQAMIJBFSCT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |