C29H38FN3O5S — CID 142475622
cyclobutyl-[2-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]sulfonyl-1-(hydroxymethyl)-7-methoxyspiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]-1'-yl]methanone;methane (PubChem CID 142475622) has the molecular formula C29H38FN3O5S and a molecular weight of 559.70 g/mol. Its IUPAC name is cyclobutyl-[2-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]sulfonyl-1-(hydroxymethyl)-7-methoxyspiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]-1'-yl]methanone;methane.
| Compound Name | cyclobutyl-[2-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]sulfonyl-1-(hydroxymethyl)-7-methoxyspiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]-1'-yl]methanone;methane |
|---|---|
| PubChem CID | 142475622 |
| Molecular Formula | C29H38FN3O5S |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | cyclobutyl-[2-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]sulfonyl-1-(hydroxymethyl)-7-methoxyspiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]-1'-yl]methanone;methane |
| SMILES | C.C=C/C=C(\C(=C)F)S(=O)(=O)N1CC2(CCN(C(=O)C3CCC3)CC2)c2c([nH]c3cc(OC)ccc23)C1CO |
| InChI | InChI=1S/C28H34FN3O5S.CH4/c1-4-6-24(18(2)29)38(35,36)32-17-28(11-13-31(14-12-28)27(34)19-7-5-8-19)25-21-10-9-20(37-3)15-22(21)30-26(25)23(32)16-33;/h4,6,9-10,15,19,23,30,33H,1-2,5,7-8,11-14,16-17H2,3H3;1H4/b24-6+; |
| InChIKey | VFOXFHVQKIXRGW-KUYVNGPJSA-N |
| XLogP | 4.70 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|