C28H43N3O4 — CID 142475590
ethane;ethyl 1'-(cyclobutanecarbonyl)-7-methoxyspiro[1,2,3,9-tetrahydropyrido[3,4-b]indole-4,4'-piperidine]-1-carboxylate (PubChem CID 142475590) has the molecular formula C28H43N3O4 and a molecular weight of 485.67 g/mol. Its IUPAC name is ethane;ethyl 1'-(cyclobutanecarbonyl)-7-methoxyspiro[1,2,3,9-tetrahydropyrido[3,4-b]indole-4,4'-piperidine]-1-carboxylate.
| Compound Name | ethane;ethyl 1'-(cyclobutanecarbonyl)-7-methoxyspiro[1,2,3,9-tetrahydropyrido[3,4-b]indole-4,4'-piperidine]-1-carboxylate |
|---|---|
| PubChem CID | 142475590 |
| Molecular Formula | C28H43N3O4 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.33 |
| IUPAC Name | ethane;ethyl 1'-(cyclobutanecarbonyl)-7-methoxyspiro[1,2,3,9-tetrahydropyrido[3,4-b]indole-4,4'-piperidine]-1-carboxylate |
| SMILES | CC.CC.CCOC(=O)C1NCC2(CCN(C(=O)C3CCC3)CC2)c2c1[nH]c1cc(OC)ccc21 |
| InChI | InChI=1S/C24H31N3O4.2C2H6/c1-3-31-23(29)21-20-19(17-8-7-16(30-2)13-18(17)26-20)24(14-25-21)9-11-27(12-10-24)22(28)15-5-4-6-15;2*1-2/h7-8,13,15,21,25-26H,3-6,9-12,14H2,1-2H3;2*1-2H3 |
| InChIKey | GUXHZJBCCMPVSQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |