C28H45N3O4Si — CID 140942858
tert-butyl (1S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methoxyspiro[1,2,3,9-tetrahydropyrido[3,4-b]indole-4,4'-piperidine]-1'-carboxylate (PubChem CID 140942858) has the molecular formula C28H45N3O4Si and a molecular weight of 515.77 g/mol. Its IUPAC name is tert-butyl (1S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methoxyspiro[1,2,3,9-tetrahydropyrido[3,4-b]indole-4,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl (1S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methoxyspiro[1,2,3,9-tetrahydropyrido[3,4-b]indole-4,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 140942858 |
| Molecular Formula | C28H45N3O4Si |
| Molecular Weight | 515.77 g/mol |
| Exact Mass | 515.32 |
| IUPAC Name | tert-butyl (1S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methoxyspiro[1,2,3,9-tetrahydropyrido[3,4-b]indole-4,4'-piperidine]-1'-carboxylate |
| SMILES | COc1ccc2c3c([nH]c2c1)[C@@H](CO[Si](C)(C)C(C)(C)C)NCC31CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C28H45N3O4Si/c1-26(2,3)35-25(32)31-14-12-28(13-15-31)18-29-22(17-34-36(8,9)27(4,5)6)24-23(28)20-11-10-19(33-7)16-21(20)30-24/h10-11,16,22,29-30H,12-15,17-18H2,1-9H3/t22-/m1/s1 |
| InChIKey | CRSZFGYVCMBYDF-JOCHJYFZSA-N |
| XLogP | 6.11 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.77 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|