C19H29NO5 — CID 170109914
tert-butyl 4-hydroxy-4-[2-(2-hydroxyethyl)-5-methoxyphenyl]piperidine-1-carboxylate (PubChem CID 170109914) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-[2-(2-hydroxyethyl)-5-methoxyphenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-[2-(2-hydroxyethyl)-5-methoxyphenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170109914 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | tert-butyl 4-hydroxy-4-[2-(2-hydroxyethyl)-5-methoxyphenyl]piperidine-1-carboxylate |
| SMILES | COc1ccc(CCO)c(C2(O)CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C19H29NO5/c1-18(2,3)25-17(22)20-10-8-19(23,9-11-20)16-13-15(24-4)6-5-14(16)7-12-21/h5-6,13,21,23H,7-12H2,1-4H3 |
| InChIKey | JSXDFZQPLLIPGC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |