C28H40N4O6S — CID 142477637
2-[5-[4-[2-(hydroxymethoxy)ethyl]piperidin-1-yl]sulfinyl-2-propoxyphenyl]-6-(hydroxymethyl)-5-methyl-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 142477637) has the molecular formula C28H40N4O6S and a molecular weight of 560.72 g/mol. Its IUPAC name is 2-[5-[4-[2-(hydroxymethoxy)ethyl]piperidin-1-yl]sulfinyl-2-propoxyphenyl]-6-(hydroxymethyl)-5-methyl-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[5-[4-[2-(hydroxymethoxy)ethyl]piperidin-1-yl]sulfinyl-2-propoxyphenyl]-6-(hydroxymethyl)-5-methyl-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 142477637 |
| Molecular Formula | C28H40N4O6S |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 2-[5-[4-[2-(hydroxymethoxy)ethyl]piperidin-1-yl]sulfinyl-2-propoxyphenyl]-6-(hydroxymethyl)-5-methyl-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CCCOc1ccc(S(=O)N2CCC(CCOCO)CC2)cc1-c1nc2c(CCC)c(CO)n(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C28H40N4O6S/c1-4-6-21-23(17-33)31(3)26-25(21)29-27(30-28(26)35)22-16-20(7-8-24(22)38-14-5-2)39(36)32-12-9-19(10-13-32)11-15-37-18-34/h7-8,16,19,33-34H,4-6,9-15,17-18H2,1-3H3,(H,29,30,35) |
| InChIKey | XWTLXBFEROZWPX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 129.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|