C30H43N6O7S+ — CID 172961067
3-[1-[3-[5-ethyl-6-[(E)-hydroxyiminomethyl]-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl]-4-propoxyphenyl]sulfonylpiperidin-4-yl]propoxy-methyl-oxoazanium (PubChem CID 172961067) has the molecular formula C30H43N6O7S+ and a molecular weight of 631.78 g/mol. Its IUPAC name is 3-[1-[3-[5-ethyl-6-[(E)-hydroxyiminomethyl]-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl]-4-propoxyphenyl]sulfonylpiperidin-4-yl]propoxy-methyl-oxoazanium.
| Compound Name | 3-[1-[3-[5-ethyl-6-[(E)-hydroxyiminomethyl]-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl]-4-propoxyphenyl]sulfonylpiperidin-4-yl]propoxy-methyl-oxoazanium |
|---|---|
| PubChem CID | 172961067 |
| Molecular Formula | C30H43N6O7S+ |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.29 |
| IUPAC Name | 3-[1-[3-[5-ethyl-6-[(E)-hydroxyiminomethyl]-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl]-4-propoxyphenyl]sulfonylpiperidin-4-yl]propoxy-methyl-oxoazanium |
| SMILES | CCCOc1ccc(S(=O)(=O)N2CCC(CCCO[N+](C)=O)CC2)cc1-c1nc2c(CCC)c(/C=N/O)n(CC)c2c(=O)[nH]1 |
| InChI | InChI=1S/C30H42N6O7S/c1-5-9-23-25(20-31-38)36(7-3)28-27(23)32-29(33-30(28)37)24-19-22(11-12-26(24)42-17-6-2)44(40,41)35-15-13-21(14-16-35)10-8-18-43-34(4)39/h11-12,19-21H,5-10,13-18H2,1-4H3,(H-,32,33,37,38)/p+1 |
| InChIKey | ZTOUMCRNHPIELG-UHFFFAOYSA-O |
| XLogP | 4.48 |
| TPSA | 159.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|