C27H36N6O8S — CID 137315704
2-[4-[3-(5-ethyl-6-formyl-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperazin-1-yl]ethyl nitrate (PubChem CID 137315704) has the molecular formula C27H36N6O8S and a molecular weight of 604.69 g/mol. Its IUPAC name is 2-[4-[3-(5-ethyl-6-formyl-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperazin-1-yl]ethyl nitrate.
| Compound Name | 2-[4-[3-(5-ethyl-6-formyl-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperazin-1-yl]ethyl nitrate |
|---|---|
| PubChem CID | 137315704 |
| Molecular Formula | C27H36N6O8S |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | 2-[4-[3-(5-ethyl-6-formyl-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperazin-1-yl]ethyl nitrate |
| SMILES | CCCOc1ccc(S(=O)(=O)N2CCN(CCO[N+](=O)[O-])CC2)cc1-c1nc2c(CCC)c(C=O)n(CC)c2c(=O)[nH]1 |
| InChI | InChI=1S/C27H36N6O8S/c1-4-7-20-22(18-34)32(6-3)25-24(20)28-26(29-27(25)35)21-17-19(8-9-23(21)40-15-5-2)42(38,39)31-12-10-30(11-13-31)14-16-41-33(36)37/h8-9,17-18H,4-7,10-16H2,1-3H3,(H,28,29,35) |
| InChIKey | HWKPVTOZANINQE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 169.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|