C32H46N6O9S — CID 146346708
2-[4-[3-(5-ethyl-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperazin-1-yl]ethyl 6-nitrooxyhexanoate (PubChem CID 146346708) has the molecular formula C32H46N6O9S and a molecular weight of 690.82 g/mol. Its IUPAC name is 2-[4-[3-(5-ethyl-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperazin-1-yl]ethyl 6-nitrooxyhexanoate.
| Compound Name | 2-[4-[3-(5-ethyl-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperazin-1-yl]ethyl 6-nitrooxyhexanoate |
|---|---|
| PubChem CID | 146346708 |
| Molecular Formula | C32H46N6O9S |
| Molecular Weight | 690.82 g/mol |
| Exact Mass | 690.30 |
| IUPAC Name | 2-[4-[3-(5-ethyl-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperazin-1-yl]ethyl 6-nitrooxyhexanoate |
| SMILES | CCCOc1ccc(S(=O)(=O)N2CCN(CCOC(=O)CCCCCO[N+](=O)[O-])CC2)cc1-c1nc2c(CCC)cn(CC)c2c(=O)[nH]1 |
| InChI | InChI=1S/C32H46N6O9S/c1-4-10-24-23-36(6-3)30-29(24)33-31(34-32(30)40)26-22-25(12-13-27(26)45-19-5-2)48(43,44)37-16-14-35(15-17-37)18-21-46-28(39)11-8-7-9-20-47-38(41)42/h12-13,22-23H,4-11,14-21H2,1-3H3,(H,33,34,40) |
| InChIKey | YCAMBEZYYUGQGE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 179.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|