C27H38N6O6S — CID 162443984
3-[4-[3-(5-ethyl-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperazin-1-yl]-N-hydroxypropanamide (PubChem CID 162443984) has the molecular formula C27H38N6O6S and a molecular weight of 574.70 g/mol. Its IUPAC name is 3-[4-[3-(5-ethyl-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperazin-1-yl]-N-hydroxypropanamide.
| Compound Name | 3-[4-[3-(5-ethyl-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperazin-1-yl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 162443984 |
| Molecular Formula | C27H38N6O6S |
| Molecular Weight | 574.70 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 3-[4-[3-(5-ethyl-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperazin-1-yl]-N-hydroxypropanamide |
| SMILES | CCCOc1ccc(S(=O)(=O)N2CCN(CCC(=O)NO)CC2)cc1-c1nc2c(CCC)cn(CC)c2c(=O)[nH]1 |
| InChI | InChI=1S/C27H38N6O6S/c1-4-7-19-18-32(6-3)25-24(19)28-26(29-27(25)35)21-17-20(8-9-22(21)39-16-5-2)40(37,38)33-14-12-31(13-15-33)11-10-23(34)30-36/h8-9,17-18,36H,4-7,10-16H2,1-3H3,(H,30,34)(H,28,29,35) |
| InChIKey | BXQNHLFHWWKNTO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 149.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.70 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|