C32H46ClN7O13S — CID 174202762
2-[4-[3-(5-ethyl-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperazin-1-yl]ethyl 3-(2,3-dinitrooxypropoxy)propanoate;hydrochloride (PubChem CID 174202762) has the molecular formula C32H46ClN7O13S and a molecular weight of 804.28 g/mol. Its IUPAC name is 2-[4-[3-(5-ethyl-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperazin-1-yl]ethyl 3-(2,3-dinitrooxypropoxy)propanoate;hydrochloride.
| Compound Name | 2-[4-[3-(5-ethyl-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperazin-1-yl]ethyl 3-(2,3-dinitrooxypropoxy)propanoate;hydrochloride |
|---|---|
| PubChem CID | 174202762 |
| Molecular Formula | C32H46ClN7O13S |
| Molecular Weight | 804.28 g/mol |
| Exact Mass | 803.26 |
| IUPAC Name | 2-[4-[3-(5-ethyl-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl)-4-propoxyphenyl]sulfonylpiperazin-1-yl]ethyl 3-(2,3-dinitrooxypropoxy)propanoate;hydrochloride |
| SMILES | CCCOc1ccc(S(=O)(=O)N2CCN(CCOC(=O)CCOCC(CO[N+](=O)[O-])O[N+](=O)[O-])CC2)cc1-c1nc2c(CCC)cn(CC)c2c(=O)[nH]1.Cl |
| InChI | InChI=1S/C32H45N7O13S.ClH/c1-4-7-23-20-36(6-3)30-29(23)33-31(34-32(30)41)26-19-25(8-9-27(26)49-16-5-2)53(46,47)37-13-11-35(12-14-37)15-18-50-28(40)10-17-48-21-24(52-39(44)45)22-51-38(42)43;/h8-9,19-20,24H,4-7,10-18,21-22H2,1-3H3,(H,33,34,41);1H |
| InChIKey | JPNVVHCQXOUTAM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 240.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|