C28H39N7O7S — CID 172954086
N-[2-[4-[3-[5-ethyl-6-[(E)-hydroxyiminomethyl]-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl]-4-propoxyphenyl]sulfonylpiperazin-1-yl]ethoxy]methanimine oxide (PubChem CID 172954086) has the molecular formula C28H39N7O7S and a molecular weight of 617.73 g/mol. Its IUPAC name is N-[2-[4-[3-[5-ethyl-6-[(E)-hydroxyiminomethyl]-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl]-4-propoxyphenyl]sulfonylpiperazin-1-yl]ethoxy]methanimine oxide.
| Compound Name | N-[2-[4-[3-[5-ethyl-6-[(E)-hydroxyiminomethyl]-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl]-4-propoxyphenyl]sulfonylpiperazin-1-yl]ethoxy]methanimine oxide |
|---|---|
| PubChem CID | 172954086 |
| Molecular Formula | C28H39N7O7S |
| Molecular Weight | 617.73 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | N-[2-[4-[3-[5-ethyl-6-[(E)-hydroxyiminomethyl]-4-oxo-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-2-yl]-4-propoxyphenyl]sulfonylpiperazin-1-yl]ethoxy]methanimine oxide |
| SMILES | C=[N+]([O-])OCCN1CCN(S(=O)(=O)c2ccc(OCCC)c(-c3nc4c(CCC)c(/C=N/O)n(CC)c4c(=O)[nH]3)c2)CC1 |
| InChI | InChI=1S/C28H39N7O7S/c1-5-8-21-23(19-29-37)35(7-3)26-25(21)30-27(31-28(26)36)22-18-20(9-10-24(22)41-16-6-2)43(39,40)34-13-11-33(12-14-34)15-17-42-32(4)38/h9-10,18-19,37H,4-8,11-17H2,1-3H3,(H,30,31,36)/b29-19+ |
| InChIKey | XMYILNXQKBMBHD-VUTHCHCSSA-N |
| XLogP | 2.41 |
| TPSA | 168.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.73 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|