C26H36N7O8S+ — CID 145311523
2-[4-[4-ethoxy-3-[5-ethyl-6-[(E)-hydroxyiminomethyl]-4-oxo-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]sulfonylpiperazin-1-yl]ethoxy-hydroxy-oxoazanium (PubChem CID 145311523) has the molecular formula C26H36N7O8S+ and a molecular weight of 606.68 g/mol. Its IUPAC name is 2-[4-[4-ethoxy-3-[5-ethyl-6-[(E)-hydroxyiminomethyl]-4-oxo-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]sulfonylpiperazin-1-yl]ethoxy-hydroxy-oxoazanium.
| Compound Name | 2-[4-[4-ethoxy-3-[5-ethyl-6-[(E)-hydroxyiminomethyl]-4-oxo-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]sulfonylpiperazin-1-yl]ethoxy-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 145311523 |
| Molecular Formula | C26H36N7O8S+ |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | 2-[4-[4-ethoxy-3-[5-ethyl-6-[(E)-hydroxyiminomethyl]-4-oxo-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]sulfonylpiperazin-1-yl]ethoxy-hydroxy-oxoazanium |
| SMILES | CCCc1c(/C=N/O)c(CC)c2c(=O)[nH]c(-c3cc(S(=O)(=O)N4CCN(CCO[N+](=O)O)CC4)ccc3OCC)nn12 |
| InChI | InChI=1S/C26H35N7O8S/c1-4-7-22-21(17-27-35)19(5-2)24-26(34)28-25(29-32(22)24)20-16-18(8-9-23(20)40-6-3)42(38,39)31-12-10-30(11-13-31)14-15-41-33(36)37/h8-9,16-17H,4-7,10-15H2,1-3H3,(H2-,28,29,34,35,36,37)/p+1/b27-17+ |
| InChIKey | KMULNDGWXLMFRZ-WPWMEQJKSA-O |
| XLogP | 1.82 |
| TPSA | 182.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|