C27H38N6O6S — CID 137308158
2-[2-ethoxy-5-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]-5-ethyl-6-(methoxyiminomethyl)-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 137308158) has the molecular formula C27H38N6O6S and a molecular weight of 574.70 g/mol. Its IUPAC name is 2-[2-ethoxy-5-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]-5-ethyl-6-(methoxyiminomethyl)-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[2-ethoxy-5-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]-5-ethyl-6-(methoxyiminomethyl)-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 137308158 |
| Molecular Formula | C27H38N6O6S |
| Molecular Weight | 574.70 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 2-[2-ethoxy-5-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]-5-ethyl-6-(methoxyiminomethyl)-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | CCCc1c(C=NOC)c(CC)c2c(=O)[nH]c(-c3cc(S(=O)(=O)N4CCN(CCO)CC4)ccc3OCC)nn12 |
| InChI | InChI=1S/C27H38N6O6S/c1-5-8-23-22(18-28-38-4)20(6-2)25-27(35)29-26(30-33(23)25)21-17-19(9-10-24(21)39-7-3)40(36,37)32-13-11-31(12-14-32)15-16-34/h9-10,17-18,34H,5-8,11-16H2,1-4H3,(H,29,30,35) |
| InChIKey | FWXCXWDQUPGVJR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.70 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|